C20H23N4O4SU- — CID 163486475
CID 163486475 (PubChem CID 163486475) has the molecular formula C20H23N4O4SU- and a molecular weight of 653.52 g/mol.
| Compound Name | CID 163486475 |
|---|---|
| PubChem CID | 163486475 |
| Molecular Formula | C20H23N4O4SU- |
| Molecular Weight | 653.52 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | — |
| SMILES | C[C-]1COc2c(S(=O)(=O)NC(=O)Nc3c4c(cc5c3CCC5)CCC4)cnn2C1.[U] |
| InChI | InChI=1S/C20H23N4O4S.U/c1-12-10-24-19(28-11-12)17(9-21-24)29(26,27)23-20(25)22-18-15-6-2-4-13(15)8-14-5-3-7-16(14)18;/h8-9H,2-7,10-11H2,1H3,(H2,22,23,25);/q-1; |
| InChIKey | MEZBLRMQQYHEMJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|