C19H20N4OS — CID 163486864
13-(dimethylamino)-4-methyl-5-(4-methylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,12-tetraen-6-one (PubChem CID 163486864) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 13-(dimethylamino)-4-methyl-5-(4-methylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,12-tetraen-6-one.
| Compound Name | 13-(dimethylamino)-4-methyl-5-(4-methylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,12-tetraen-6-one |
|---|---|
| PubChem CID | 163486864 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 13-(dimethylamino)-4-methyl-5-(4-methylphenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,12-tetraen-6-one |
| SMILES | Cc1ccc(-n2c(C)nc3c4c(sc3c2=O)NCC=C4N(C)C)cc1 |
| InChI | InChI=1S/C19H20N4OS/c1-11-5-7-13(8-6-11)23-12(2)21-16-15-14(22(3)4)9-10-20-18(15)25-17(16)19(23)24/h5-9,20H,10H2,1-4H3 |
| InChIKey | CJGZJILLMDTKCW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |