C30H23N3O3 — CID 163487065
4-[(3aR)-4-[(E)-3-(4-cyanophenyl)prop-2-enyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 163487065) has the molecular formula C30H23N3O3 and a molecular weight of 473.53 g/mol. Its IUPAC name is 4-[(3aR)-4-[(E)-3-(4-cyanophenyl)prop-2-enyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(3aR)-4-[(E)-3-(4-cyanophenyl)prop-2-enyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 163487065 |
| Molecular Formula | C30H23N3O3 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-[(3aR)-4-[(E)-3-(4-cyanophenyl)prop-2-enyl]-7-methyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | CC12CCC(C/C=C/c3ccc(C#N)cc3)(O1)[C@@H]1C(=O)N(c3ccc(C#N)c4ccccc34)C(=O)C12 |
| InChI | InChI=1S/C30H23N3O3/c1-29-15-16-30(36-29,14-4-5-19-8-10-20(17-31)11-9-19)26-25(29)27(34)33(28(26)35)24-13-12-21(18-32)22-6-2-3-7-23(22)24/h2-13,25-26H,14-16H2,1H3/b5-4+/t25?,26-,29?,30?/m0/s1 |
| InChIKey | CJLKKEBZXLZIJL-DQVQCXMWSA-N |
| XLogP | 5.11 |
| TPSA | 94.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|