C10H18O2 — CID 163487182
(4S)-3,5-dimethoxy-1,4-dimethylcyclohexene (PubChem CID 163487182) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (4S)-3,5-dimethoxy-1,4-dimethylcyclohexene.
| Compound Name | (4S)-3,5-dimethoxy-1,4-dimethylcyclohexene |
|---|---|
| PubChem CID | 163487182 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4S)-3,5-dimethoxy-1,4-dimethylcyclohexene |
| SMILES | COC1C=C(C)CC(OC)[C@@H]1C |
| InChI | InChI=1S/C10H18O2/c1-7-5-9(11-3)8(2)10(6-7)12-4/h5,8-10H,6H2,1-4H3/t8-,9?,10?/m1/s1 |
| InChIKey | CJNYMQYRLBYVTH-XNWIYYODSA-N |
| XLogP | 2.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|