About CID 163487425
CID 163487425 (PubChem CID 163487425) has the molecular formula C6H6BFN2
and a molecular weight of 135.94 g/mol.
Molecular Properties
| Compound Name | CID 163487425 |
| PubChem CID | 163487425 |
| Molecular Formula | C6H6BFN2 |
| Molecular Weight | 135.94 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NN)c(F)c1 |
| InChI | InChI=1S/C6H6BFN2/c7-4-1-2-6(10-9)5(8)3-4/h1-3,10H,9H2 |
| InChIKey | MPOALPVFRODVNH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.94 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 163487425 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163487425?
The IUPAC name of CID 163487425 (CID 163487425) is not available.
What is the SMILES notation for CID 163487425?
The canonical SMILES for CID 163487425 is [B]c1ccc(NN)c(F)c1.
What is the InChIKey of CID 163487425?
The InChIKey is MPOALPVFRODVNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BFN2/c7-4-1-2-6(10-9)5(8)3-4/h1-3,10H,9H2.
What are the key properties of CID 163487425?
CID 163487425 has a molecular weight of 135.94 g/mol, XLogP of -0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163487425 is sourced from PubChem (CID 163487425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).