About 5-amino-4-ethyl-1,2,4-triazolidine-3-thione
5-amino-4-ethyl-1,2,4-triazolidine-3-thione (PubChem CID 163488006) has the molecular formula C4H10N4S
and a molecular weight of 146.22 g/mol. Its IUPAC name is 5-amino-4-ethyl-1,2,4-triazolidine-3-thione.
Molecular Properties
| Compound Name | 5-amino-4-ethyl-1,2,4-triazolidine-3-thione |
| PubChem CID | 163488006 |
| Molecular Formula | C4H10N4S |
| Molecular Weight | 146.22 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 5-amino-4-ethyl-1,2,4-triazolidine-3-thione |
| SMILES | CCN1C(=S)NNC1N |
| InChI | InChI=1S/C4H10N4S/c1-2-8-3(5)6-7-4(8)9/h3,6H,2,5H2,1H3,(H,7,9) |
| InChIKey | CKFDQXBJALEARL-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.22 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-ethyl-1,2,4-triazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-ethyl-1,2,4-triazolidine-3-thione?
The IUPAC name of 5-amino-4-ethyl-1,2,4-triazolidine-3-thione (CID 163488006) is 5-amino-4-ethyl-1,2,4-triazolidine-3-thione.
What is the SMILES notation for 5-amino-4-ethyl-1,2,4-triazolidine-3-thione?
The canonical SMILES for 5-amino-4-ethyl-1,2,4-triazolidine-3-thione is CCN1C(=S)NNC1N.
What is the InChIKey of 5-amino-4-ethyl-1,2,4-triazolidine-3-thione?
The InChIKey is CKFDQXBJALEARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4S/c1-2-8-3(5)6-7-4(8)9/h3,6H,2,5H2,1H3,(H,7,9).
What are the key properties of 5-amino-4-ethyl-1,2,4-triazolidine-3-thione?
5-amino-4-ethyl-1,2,4-triazolidine-3-thione has a molecular weight of 146.22 g/mol, XLogP of -1.06, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-ethyl-1,2,4-triazolidine-3-thione is sourced from PubChem (CID 163488006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).