C17H19N5 — CID 163488549
2-cyclohexyl-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 163488549) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-cyclohexyl-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 2-cyclohexyl-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 163488549 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-cyclohexyl-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | Nc1nc(-c2ccccc2)cc2nc(C3CCCCC3)nn12 |
| InChI | InChI=1S/C17H19N5/c18-17-19-14(12-7-3-1-4-8-12)11-15-20-16(21-22(15)17)13-9-5-2-6-10-13/h1,3-4,7-8,11,13H,2,5-6,9-10H2,(H2,18,19) |
| InChIKey | SODFKIRLIGMNKN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |