C13H14ClN3O2 — CID 163488554
ethyl 2-(12-chloro-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-5-yl)acetate (PubChem CID 163488554) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is ethyl 2-(12-chloro-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-5-yl)acetate.
| Compound Name | ethyl 2-(12-chloro-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-5-yl)acetate |
|---|---|
| PubChem CID | 163488554 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | ethyl 2-(12-chloro-8,9,11-triazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraen-5-yl)acetate |
| SMILES | CCOC(=O)CC1CCc2c1cn1ncnc(Cl)c21 |
| InChI | InChI=1S/C13H14ClN3O2/c1-2-19-11(18)5-8-3-4-9-10(8)6-17-12(9)13(14)15-7-16-17/h6-8H,2-5H2,1H3 |
| InChIKey | CKQBXTWPZHKBOK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |