About (2,4-dimethyloxolan-3-yl) propane-1-sulfonate
(2,4-dimethyloxolan-3-yl) propane-1-sulfonate (PubChem CID 163488838) has the molecular formula C9H18O4S
and a molecular weight of 222.31 g/mol. Its IUPAC name is (2,4-dimethyloxolan-3-yl) propane-1-sulfonate.
Molecular Properties
| Compound Name | (2,4-dimethyloxolan-3-yl) propane-1-sulfonate |
| PubChem CID | 163488838 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2,4-dimethyloxolan-3-yl) propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OC1C(C)COC1C |
| InChI | InChI=1S/C9H18O4S/c1-4-5-14(10,11)13-9-7(2)6-12-8(9)3/h7-9H,4-6H2,1-3H3 |
| InChIKey | CKVUUOGKFNZTMO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dimethyloxolan-3-yl) propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethyloxolan-3-yl) propane-1-sulfonate?
The IUPAC name of (2,4-dimethyloxolan-3-yl) propane-1-sulfonate (CID 163488838) is (2,4-dimethyloxolan-3-yl) propane-1-sulfonate.
What is the SMILES notation for (2,4-dimethyloxolan-3-yl) propane-1-sulfonate?
The canonical SMILES for (2,4-dimethyloxolan-3-yl) propane-1-sulfonate is CCCS(=O)(=O)OC1C(C)COC1C.
What is the InChIKey of (2,4-dimethyloxolan-3-yl) propane-1-sulfonate?
The InChIKey is CKVUUOGKFNZTMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S/c1-4-5-14(10,11)13-9-7(2)6-12-8(9)3/h7-9H,4-6H2,1-3H3.
What are the key properties of (2,4-dimethyloxolan-3-yl) propane-1-sulfonate?
(2,4-dimethyloxolan-3-yl) propane-1-sulfonate has a molecular weight of 222.31 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyloxolan-3-yl) propane-1-sulfonate is sourced from PubChem (CID 163488838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).