C31H24F3NO — CID 163489354
15,15,25,25-tetramethyl-12-(trifluoromethyl)-10-oxaheptacyclo[14.11.0.02,14.03,11.04,9.018,26.019,24]heptacosa-1(16),2,4,6,8,11,13,17,19(24),20,22,26-dodecaen-22-amine (PubChem CID 163489354) has the molecular formula C31H24F3NO and a molecular weight of 483.53 g/mol. Its IUPAC name is 15,15,25,25-tetramethyl-12-(trifluoromethyl)-10-oxaheptacyclo[14.11.0.02,14.03,11.04,9.018,26.019,24]heptacosa-1(16),2,4,6,8,11,13,17,19(24),20,22,26-dodecaen-22-amine.
| Compound Name | 15,15,25,25-tetramethyl-12-(trifluoromethyl)-10-oxaheptacyclo[14.11.0.02,14.03,11.04,9.018,26.019,24]heptacosa-1(16),2,4,6,8,11,13,17,19(24),20,22,26-dodecaen-22-amine |
|---|---|
| PubChem CID | 163489354 |
| Molecular Formula | C31H24F3NO |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 15,15,25,25-tetramethyl-12-(trifluoromethyl)-10-oxaheptacyclo[14.11.0.02,14.03,11.04,9.018,26.019,24]heptacosa-1(16),2,4,6,8,11,13,17,19(24),20,22,26-dodecaen-22-amine |
| SMILES | CC1(C)c2cc(N)ccc2-c2cc3c(cc21)-c1c(cc(C(F)(F)F)c2oc4ccccc4c12)C3(C)C |
| InChI | InChI=1S/C31H24F3NO/c1-29(2)20-11-15(35)9-10-16(20)18-12-22-19(13-21(18)29)26-23(30(22,3)4)14-24(31(32,33)34)28-27(26)17-7-5-6-8-25(17)36-28/h5-14H,35H2,1-4H3 |
| InChIKey | CLGDMBPGQODTGU-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|