C19H19ClN4O2 — CID 163489528
5-amino-4-chloro-2-[furan-2-ylmethyl(methyl)amino]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 163489528) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 5-amino-4-chloro-2-[furan-2-ylmethyl(methyl)amino]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-amino-4-chloro-2-[furan-2-ylmethyl(methyl)amino]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 163489528 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 5-amino-4-chloro-2-[furan-2-ylmethyl(methyl)amino]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CN(Cc1ccco1)c1cc(Cl)c(N)cc1C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-24(12-14-5-3-7-26-14)18-9-16(20)17(21)8-15(18)19(25)23-11-13-4-2-6-22-10-13/h2-10H,11-12,21H2,1H3,(H,23,25) |
| InChIKey | CLJWLSYONCAJEN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|