About 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran
2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran (PubChem CID 163489878) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran |
| PubChem CID | 163489878 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran |
| SMILES | CCOCc1cc2cc(C)c(C)c(C)c2o1 |
| InChI | InChI=1S/C14H18O2/c1-5-15-8-13-7-12-6-9(2)10(3)11(4)14(12)16-13/h6-7H,5,8H2,1-4H3 |
| InChIKey | CBKCYRNOLOMSKI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran?
The IUPAC name of 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran (CID 163489878) is 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran.
What is the SMILES notation for 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran?
The canonical SMILES for 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran is CCOCc1cc2cc(C)c(C)c(C)c2o1.
What is the InChIKey of 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran?
The InChIKey is CBKCYRNOLOMSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-5-15-8-13-7-12-6-9(2)10(3)11(4)14(12)16-13/h6-7H,5,8H2,1-4H3.
What are the key properties of 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran?
2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran has a molecular weight of 218.30 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethoxymethyl)-5,6,7-trimethyl-1-benzofuran is sourced from PubChem (CID 163489878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).