C23H20IN8O- — CID 163490010
CID 163490010 (PubChem CID 163490010) has the molecular formula C23H20IN8O- and a molecular weight of 551.37 g/mol.
| Compound Name | CID 163490010 |
|---|---|
| PubChem CID | 163490010 |
| Molecular Formula | C23H20IN8O- |
| Molecular Weight | 551.37 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | — |
| SMILES | CC(C)CC(=O)Nc1cncc(-c2cnc3n[nH]c(-c4nc5c([nH]4)[I-]CC=C5C#N)c3c2)c1 |
| InChI | InChI=1S/C23H20IN8O/c1-12(2)5-18(33)28-16-6-14(9-26-11-16)15-7-17-20(31-32-22(17)27-10-15)23-29-19-13(8-25)3-4-24-21(19)30-23/h3,6-7,9-12H,4-5H2,1-2H3,(H,28,33)(H,29,30)(H,27,31,32)/q-1 |
| InChIKey | VRZFXJQYABLYQB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|