C24H28N2O4 — CID 163490703
(4aS,9S)-5,6-dihydroxy-2-methoxy-4a-(methylaminomethyl)-9-(2-methylanilino)-4,9,10,10a-tetrahydrophenanthren-3-one (PubChem CID 163490703) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (4aS,9S)-5,6-dihydroxy-2-methoxy-4a-(methylaminomethyl)-9-(2-methylanilino)-4,9,10,10a-tetrahydrophenanthren-3-one.
| Compound Name | (4aS,9S)-5,6-dihydroxy-2-methoxy-4a-(methylaminomethyl)-9-(2-methylanilino)-4,9,10,10a-tetrahydrophenanthren-3-one |
|---|---|
| PubChem CID | 163490703 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (4aS,9S)-5,6-dihydroxy-2-methoxy-4a-(methylaminomethyl)-9-(2-methylanilino)-4,9,10,10a-tetrahydrophenanthren-3-one |
| SMILES | CNC[C@@]12CC(=O)C(OC)=CC1C[C@H](Nc1ccccc1C)c1ccc(O)c(O)c12 |
| InChI | InChI=1S/C24H28N2O4/c1-14-6-4-5-7-17(14)26-18-10-15-11-21(30-3)20(28)12-24(15,13-25-2)22-16(18)8-9-19(27)23(22)29/h4-9,11,15,18,25-27,29H,10,12-13H2,1-3H3/t15?,18-,24-/m0/s1 |
| InChIKey | CMJFJQNVSAIAPZ-SKKBENIFSA-N |
| XLogP | 3.54 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|