C26H40O3 — CID 163490839
2-tert-butyl-4-methoxyphenol;2-tert-butyl-4-methyl-6-(2-methylpropyl)phenol (PubChem CID 163490839) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is 2-tert-butyl-4-methoxyphenol;2-tert-butyl-4-methyl-6-(2-methylpropyl)phenol.
| Compound Name | 2-tert-butyl-4-methoxyphenol;2-tert-butyl-4-methyl-6-(2-methylpropyl)phenol |
|---|---|
| PubChem CID | 163490839 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 2-tert-butyl-4-methoxyphenol;2-tert-butyl-4-methyl-6-(2-methylpropyl)phenol |
| SMILES | COc1ccc(O)c(C(C)(C)C)c1.Cc1cc(CC(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O.C11H16O2/c1-10(2)7-12-8-11(3)9-13(14(12)16)15(4,5)6;1-11(2,3)9-7-8(13-4)5-6-10(9)12/h8-10,16H,7H2,1-6H3;5-7,12H,1-4H3 |
| InChIKey | CMMFBSGPFHAALC-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |