C18H20IN2O4- — CID 163491913
2-(1,4-dioxan-2-ylmethoxy)-9-methyliodanuidyl-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 163491913) has the molecular formula C18H20IN2O4- and a molecular weight of 455.27 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-ylmethoxy)-9-methyliodanuidyl-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 2-(1,4-dioxan-2-ylmethoxy)-9-methyliodanuidyl-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 163491913 |
| Molecular Formula | C18H20IN2O4- |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-(1,4-dioxan-2-ylmethoxy)-9-methyliodanuidyl-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | C[I-]c1ccc2c(c1)CCn1c-2cc(OCC2COCCO2)nc1=O |
| InChI | InChI=1S/C18H20IN2O4/c1-19-13-2-3-15-12(8-13)4-5-21-16(15)9-17(20-18(21)22)25-11-14-10-23-6-7-24-14/h2-3,8-9,14H,4-7,10-11H2,1H3/q-1 |
| InChIKey | QVBWDWDBSJLGBW-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|