C16H20N6O — CID 163492644
amino-[4-[[4-(propan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]methanol (PubChem CID 163492644) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is amino-[4-[[4-(propan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]methanol.
| Compound Name | amino-[4-[[4-(propan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]methanol |
|---|---|
| PubChem CID | 163492644 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | amino-[4-[[4-(propan-2-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenyl]methanol |
| SMILES | CC(C)Nc1nc(Nc2ccc(C(N)O)cc2)nc2[nH]ccc12 |
| InChI | InChI=1S/C16H20N6O/c1-9(2)19-15-12-7-8-18-14(12)21-16(22-15)20-11-5-3-10(4-6-11)13(17)23/h3-9,13,23H,17H2,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | CNYNVBKAHJKIIB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|