C13H21NO2 — CID 163493322
6,7-dimethoxy-N-methyl-1,2,3,4,4a,5-hexahydronaphthalen-2-amine (PubChem CID 163493322) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 6,7-dimethoxy-N-methyl-1,2,3,4,4a,5-hexahydronaphthalen-2-amine.
| Compound Name | 6,7-dimethoxy-N-methyl-1,2,3,4,4a,5-hexahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 163493322 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 6,7-dimethoxy-N-methyl-1,2,3,4,4a,5-hexahydronaphthalen-2-amine |
| SMILES | CNC1CCC2CC(OC)=C(OC)C=C2C1 |
| InChI | InChI=1S/C13H21NO2/c1-14-11-5-4-9-7-12(15-2)13(16-3)8-10(9)6-11/h8-9,11,14H,4-7H2,1-3H3 |
| InChIKey | COMDWQCRDOWVDY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |