About 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile
2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile (PubChem CID 163493990) has the molecular formula C20H17NO6
and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile |
| PubChem CID | 163493990 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile |
| SMILES | COCOc1ccc(OCOC)c2c1C(=O)c1ccc(CC#N)cc1C2=O |
| InChI | InChI=1S/C20H17NO6/c1-24-10-26-15-5-6-16(27-11-25-2)18-17(15)19(22)13-4-3-12(7-8-21)9-14(13)20(18)23/h3-6,9H,7,10-11H2,1-2H3 |
| InChIKey | CPCIZLSTLDWHDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile?
The IUPAC name of 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile (CID 163493990) is 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile.
What is the SMILES notation for 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile?
The canonical SMILES for 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile is COCOc1ccc(OCOC)c2c1C(=O)c1ccc(CC#N)cc1C2=O.
What is the InChIKey of 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile?
The InChIKey is CPCIZLSTLDWHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO6/c1-24-10-26-15-5-6-16(27-11-25-2)18-17(15)19(22)13-4-3-12(7-8-21)9-14(13)20(18)23/h3-6,9H,7,10-11H2,1-2H3.
What are the key properties of 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile?
2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile has a molecular weight of 367.36 g/mol, XLogP of 2.49, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,8-bis(methoxymethoxy)-9,10-dioxoanthracen-2-yl]acetonitrile is sourced from PubChem (CID 163493990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).