C12H24N2 — CID 163494163
(Z,4S,6S)-1-N,6-N,2,4-tetramethyl-3-methylidenehept-1-ene-1,6-diamine (PubChem CID 163494163) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (Z,4S,6S)-1-N,6-N,2,4-tetramethyl-3-methylidenehept-1-ene-1,6-diamine.
| Compound Name | (Z,4S,6S)-1-N,6-N,2,4-tetramethyl-3-methylidenehept-1-ene-1,6-diamine |
|---|---|
| PubChem CID | 163494163 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (Z,4S,6S)-1-N,6-N,2,4-tetramethyl-3-methylidenehept-1-ene-1,6-diamine |
| SMILES | C=C(/C(C)=C\NC)[C@@H](C)C[C@H](C)NC |
| InChI | InChI=1S/C12H24N2/c1-9(7-11(3)14-6)12(4)10(2)8-13-5/h8-9,11,13-14H,4,7H2,1-3,5-6H3/b10-8-/t9-,11-/m0/s1 |
| InChIKey | CPGDDPQBVAAODD-SMQKJXJPSA-N |
| XLogP | 2.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|