About 3-N-methyl-2,4-dihydrotriazole-3,5-diamine
3-N-methyl-2,4-dihydrotriazole-3,5-diamine (PubChem CID 163495469) has the molecular formula C3H9N5
and a molecular weight of 115.14 g/mol. Its IUPAC name is 3-N-methyl-2,4-dihydrotriazole-3,5-diamine.
Molecular Properties
| Compound Name | 3-N-methyl-2,4-dihydrotriazole-3,5-diamine |
| PubChem CID | 163495469 |
| Molecular Formula | C3H9N5 |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | 3-N-methyl-2,4-dihydrotriazole-3,5-diamine |
| SMILES | CNN1CC(N)=NN1 |
| InChI | InChI=1S/C3H9N5/c1-5-8-2-3(4)6-7-8/h5,7H,2H2,1H3,(H2,4,6) |
| InChIKey | CQHSNPGQPULEDC-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-N-methyl-2,4-dihydrotriazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-methyl-2,4-dihydrotriazole-3,5-diamine?
The IUPAC name of 3-N-methyl-2,4-dihydrotriazole-3,5-diamine (CID 163495469) is 3-N-methyl-2,4-dihydrotriazole-3,5-diamine.
What is the SMILES notation for 3-N-methyl-2,4-dihydrotriazole-3,5-diamine?
The canonical SMILES for 3-N-methyl-2,4-dihydrotriazole-3,5-diamine is CNN1CC(N)=NN1.
What is the InChIKey of 3-N-methyl-2,4-dihydrotriazole-3,5-diamine?
The InChIKey is CQHSNPGQPULEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N5/c1-5-8-2-3(4)6-7-8/h5,7H,2H2,1H3,(H2,4,6).
What are the key properties of 3-N-methyl-2,4-dihydrotriazole-3,5-diamine?
3-N-methyl-2,4-dihydrotriazole-3,5-diamine has a molecular weight of 115.14 g/mol, XLogP of -1.79, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-methyl-2,4-dihydrotriazole-3,5-diamine is sourced from PubChem (CID 163495469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).