C11H18F3N — CID 163496500
(2Z,4E)-4-tert-butyl-1,1,1-trifluorohepta-2,4-dien-2-amine (PubChem CID 163496500) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is (2Z,4E)-4-tert-butyl-1,1,1-trifluorohepta-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-4-tert-butyl-1,1,1-trifluorohepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 163496500 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2Z,4E)-4-tert-butyl-1,1,1-trifluorohepta-2,4-dien-2-amine |
| SMILES | CC/C=C(\C=C(/N)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C11H18F3N/c1-5-6-8(10(2,3)4)7-9(15)11(12,13)14/h6-7H,5,15H2,1-4H3/b8-6+,9-7- |
| InChIKey | CREBNRBRDLYGHB-FFELTBSMSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|