C21H22F2O7S — CID 163496843
2-[[4-(4-ethenylbenzoyl)oxy-1-tricyclo[3.3.1.03,7]nonanyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 163496843) has the molecular formula C21H22F2O7S and a molecular weight of 456.46 g/mol. Its IUPAC name is 2-[[4-(4-ethenylbenzoyl)oxy-1-tricyclo[3.3.1.03,7]nonanyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[4-(4-ethenylbenzoyl)oxy-1-tricyclo[3.3.1.03,7]nonanyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163496843 |
| Molecular Formula | C21H22F2O7S |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 2-[[4-(4-ethenylbenzoyl)oxy-1-tricyclo[3.3.1.03,7]nonanyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | C=Cc1ccc(C(=O)OC2C3CC4CC(COC(=O)C(F)(F)S(=O)(=O)O)(C3)CC42)cc1 |
| InChI | InChI=1S/C21H22F2O7S/c1-2-12-3-5-13(6-4-12)18(24)30-17-15-7-14-8-20(9-15,10-16(14)17)11-29-19(25)21(22,23)31(26,27)28/h2-6,14-17H,1,7-11H2,(H,26,27,28) |
| InChIKey | CRLMNBUKZVGCJS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|