C23H42F13N3O4S2 — CID 163497014
1,1,2,2,3,3-hexafluorobutane-1-sulfonyl fluoride;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine;N',N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 163497014) has the molecular formula C23H42F13N3O4S2 and a molecular weight of 735.71 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorobutane-1-sulfonyl fluoride;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine;N',N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonyl fluoride;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine;N',N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 163497014 |
| Molecular Formula | C23H42F13N3O4S2 |
| Molecular Weight | 735.71 g/mol |
| Exact Mass | 735.24 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonyl fluoride;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine;N',N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)F.CN(C)CC(C)(C)CCS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F.CN(C)CC(C)(C)CN |
| InChI | InChI=1S/C12H21F6NO2S.C7H18N2.C4H3F7O2S/c1-9(2,8-19(4)5)6-7-22(20,21)12(17,18)11(15,16)10(3,13)14;1-7(2,5-8)6-9(3)4;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h6-8H2,1-5H3;5-6,8H2,1-4H3;1H3 |
| InChIKey | CROSJBNXDHILCO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|