C12H21F6NO2S — CID 163497015
4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine (PubChem CID 163497015) has the molecular formula C12H21F6NO2S and a molecular weight of 357.36 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine.
| Compound Name | 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine |
|---|---|
| PubChem CID | 163497015 |
| Molecular Formula | C12H21F6NO2S |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine |
| SMILES | CN(C)CC(C)(C)CCS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C12H21F6NO2S/c1-9(2,8-19(4)5)6-7-22(20,21)12(17,18)11(15,16)10(3,13)14/h6-8H2,1-5H3 |
| InChIKey | QTHVOPMDKCIQDR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|