C18H23FO5 — CID 163497071
diethyl (3R)-2-[2-(2-fluoro-4-methylphenyl)prop-2-enyl]-3-hydroxybutanedioate (PubChem CID 163497071) has the molecular formula C18H23FO5 and a molecular weight of 338.38 g/mol. Its IUPAC name is diethyl (3R)-2-[2-(2-fluoro-4-methylphenyl)prop-2-enyl]-3-hydroxybutanedioate.
| Compound Name | diethyl (3R)-2-[2-(2-fluoro-4-methylphenyl)prop-2-enyl]-3-hydroxybutanedioate |
|---|---|
| PubChem CID | 163497071 |
| Molecular Formula | C18H23FO5 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | diethyl (3R)-2-[2-(2-fluoro-4-methylphenyl)prop-2-enyl]-3-hydroxybutanedioate |
| SMILES | C=C(CC(C(=O)OCC)[C@@H](O)C(=O)OCC)c1ccc(C)cc1F |
| InChI | InChI=1S/C18H23FO5/c1-5-23-17(21)14(16(20)18(22)24-6-2)10-12(4)13-8-7-11(3)9-15(13)19/h7-9,14,16,20H,4-6,10H2,1-3H3/t14?,16-/m1/s1 |
| InChIKey | CRPZGRVTKHYIFF-BZSJEYESSA-N |
| XLogP | 2.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |