C29H34Cl2N10 — CID 163499034
6-N-[2-[[2-[1-(cyclopropylmethyl)piperidin-4-yl]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]-3-(methyliminomethyl)pyridine-2,6-diamine (PubChem CID 163499034) has the molecular formula C29H34Cl2N10 and a molecular weight of 593.57 g/mol. Its IUPAC name is 6-N-[2-[[2-[1-(cyclopropylmethyl)piperidin-4-yl]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]-3-(methyliminomethyl)pyridine-2,6-diamine.
| Compound Name | 6-N-[2-[[2-[1-(cyclopropylmethyl)piperidin-4-yl]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]-3-(methyliminomethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 163499034 |
| Molecular Formula | C29H34Cl2N10 |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 6-N-[2-[[2-[1-(cyclopropylmethyl)piperidin-4-yl]-7-(2,4-dichlorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-yl]amino]ethyl]-3-(methyliminomethyl)pyridine-2,6-diamine |
| SMILES | C/N=C/c1ccc(NCCNc2nc(-c3ccc(Cl)cc3Cl)cc3nc(C4CCN(CC5CC5)CC4)nn23)nc1N |
| InChI | InChI=1S/C29H34Cl2N10/c1-33-16-20-4-7-25(37-27(20)32)34-10-11-35-29-36-24(22-6-5-21(30)14-23(22)31)15-26-38-28(39-41(26)29)19-8-12-40(13-9-19)17-18-2-3-18/h4-7,14-16,18-19H,2-3,8-13,17H2,1H3,(H,35,36)(H3,32,34,37)/b33-16+ |
| InChIKey | CTDGVBJACFKXCA-MHDJOFBISA-N |
| XLogP | 5.24 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|