C10H14ClNO — CID 163499388
(1R,2R)-1-(chloroamino)-1,2,3,4,6,7-hexahydronaphthalen-2-ol (PubChem CID 163499388) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is (1R,2R)-1-(chloroamino)-1,2,3,4,6,7-hexahydronaphthalen-2-ol.
| Compound Name | (1R,2R)-1-(chloroamino)-1,2,3,4,6,7-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163499388 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (1R,2R)-1-(chloroamino)-1,2,3,4,6,7-hexahydronaphthalen-2-ol |
| SMILES | O[C@@H]1CCC2=CCCC=C2[C@H]1NCl |
| InChI | InChI=1S/C10H14ClNO/c11-12-10-8-4-2-1-3-7(8)5-6-9(10)13/h3-4,9-10,12-13H,1-2,5-6H2/t9-,10-/m1/s1 |
| InChIKey | CTKKBYQKZTYOGU-NXEZZACHSA-N |
| XLogP | 1.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|