C20H18Cl2F4O2S — CID 163499856
ethyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobutyl]-2-methylsulfanylbenzoate (PubChem CID 163499856) has the molecular formula C20H18Cl2F4O2S and a molecular weight of 469.33 g/mol. Its IUPAC name is ethyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobutyl]-2-methylsulfanylbenzoate.
| Compound Name | ethyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobutyl]-2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 163499856 |
| Molecular Formula | C20H18Cl2F4O2S |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | ethyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobutyl]-2-methylsulfanylbenzoate |
| SMILES | CCOC(=O)c1ccc(CCC(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1SC |
| InChI | InChI=1S/C20H18Cl2F4O2S/c1-3-28-19(27)13-6-4-11(8-17(13)29-2)5-7-14(20(24,25)26)12-9-15(21)18(23)16(22)10-12/h4,6,8-10,14H,3,5,7H2,1-2H3 |
| InChIKey | CTUGFBUYGGYFGC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|