C21H23F2N5O6P+ — CID 163500829
[3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-[1-(3,5-difluorophenyl)-3-hydroxypropoxy]-oxophosphanium (PubChem CID 163500829) has the molecular formula C21H23F2N5O6P+ and a molecular weight of 510.41 g/mol. Its IUPAC name is [3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-[1-(3,5-difluorophenyl)-3-hydroxypropoxy]-oxophosphanium.
| Compound Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-[1-(3,5-difluorophenyl)-3-hydroxypropoxy]-oxophosphanium |
|---|---|
| PubChem CID | 163500829 |
| Molecular Formula | C21H23F2N5O6P+ |
| Molecular Weight | 510.41 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-5-hydroxy-2-methylidenecyclopentyl]methoxy-[1-(3,5-difluorophenyl)-3-hydroxypropoxy]-oxophosphanium |
| SMILES | C=C1C(CO[P+](=O)OC(CCO)c2cc(F)cc(F)c2)C(O)CC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C21H22F2N5O6P/c1-10-14(8-33-35(32)34-17(2-3-29)11-4-12(22)6-13(23)5-11)16(30)7-15(10)28-9-25-18-19(28)26-21(24)27-20(18)31/h4-6,9,14-17,29-30H,1-3,7-8H2,(H2-,24,26,27,31)/p+1 |
| InChIKey | UUMAAAVHJKOGHB-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|