C20H28FN9O — CID 163502215
N-[2-[[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-hydrazinylideneethylidene]amino]ethyl]-2-(methylamino)acetamide (PubChem CID 163502215) has the molecular formula C20H28FN9O and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[2-[[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-hydrazinylideneethylidene]amino]ethyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-[[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-hydrazinylideneethylidene]amino]ethyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 163502215 |
| Molecular Formula | C20H28FN9O |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[2-[[2-[2-(3-fluoroanilino)-4-(propylamino)pyrimidin-5-yl]-2-hydrazinylideneethylidene]amino]ethyl]-2-(methylamino)acetamide |
| SMILES | CCCNc1nc(Nc2cccc(F)c2)ncc1C(/C=N/CCNC(=O)CNC)=NN |
| InChI | InChI=1S/C20H28FN9O/c1-3-7-26-19-16(17(30-22)12-24-8-9-25-18(31)13-23-2)11-27-20(29-19)28-15-6-4-5-14(21)10-15/h4-6,10-12,23H,3,7-9,13,22H2,1-2H3,(H,25,31)(H2,26,27,28,29)/b24-12+,30-17? |
| InChIKey | KTBWAQFDKUGSBV-PWBRKWQJSA-N |
| XLogP | 1.25 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|