About 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene
1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene (PubChem CID 163502254) has the molecular formula C10H12F2
and a molecular weight of 170.20 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene |
| PubChem CID | 163502254 |
| Molecular Formula | C10H12F2 |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene |
| SMILES | C/C=C(\C)C1=CC(F)=CCC1F |
| InChI | InChI=1S/C10H12F2/c1-3-7(2)9-6-8(11)4-5-10(9)12/h3-4,6,10H,5H2,1-2H3/b7-3+ |
| InChIKey | CVTPFWRWKHKYND-XVNBXDOJSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene?
The IUPAC name of 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene (CID 163502254) is 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene.
What is the SMILES notation for 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene?
The canonical SMILES for 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene is C/C=C(\C)C1=CC(F)=CCC1F.
What is the InChIKey of 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene?
The InChIKey is CVTPFWRWKHKYND-XVNBXDOJSA-N. The full InChI is InChI=1S/C10H12F2/c1-3-7(2)9-6-8(11)4-5-10(9)12/h3-4,6,10H,5H2,1-2H3/b7-3+.
What are the key properties of 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene?
1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene has a molecular weight of 170.20 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-2-en-2-yl]-3,6-difluorocyclohexa-1,3-diene is sourced from PubChem (CID 163502254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).