About (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one
(1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one (PubChem CID 163502339) has the molecular formula C20H32O2
and a molecular weight of 304.47 g/mol. Its IUPAC name is (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one.
Molecular Properties
| Compound Name | (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one |
| PubChem CID | 163502339 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one |
| SMILES | CC(=O)C1C/C(=C/C(=O)C(C)C2CCCCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C20H32O2/c1-14(17-8-6-5-7-9-17)19(22)11-16-10-18(15(2)21)13-20(3,4)12-16/h11,14,17-18H,5-10,12-13H2,1-4H3/b16-11- |
| InChIKey | CVVBODNJKPRGAD-WJDWOHSUSA-N |
| XLogP | 5.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one?
The IUPAC name of (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one (CID 163502339) is (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one.
What is the SMILES notation for (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one?
The canonical SMILES for (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one is CC(=O)C1C/C(=C/C(=O)C(C)C2CCCCC2)CC(C)(C)C1.
What is the InChIKey of (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one?
The InChIKey is CVVBODNJKPRGAD-WJDWOHSUSA-N. The full InChI is InChI=1S/C20H32O2/c1-14(17-8-6-5-7-9-17)19(22)11-16-10-18(15(2)21)13-20(3,4)12-16/h11,14,17-18H,5-10,12-13H2,1-4H3/b16-11-.
What are the key properties of (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one?
(1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one has a molecular weight of 304.47 g/mol, XLogP of 5.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(5-acetyl-3,3-dimethylcyclohexylidene)-3-cyclohexylbutan-2-one is sourced from PubChem (CID 163502339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).