C52H46BF4N3 — CID 163502653
4,18-ditert-butyl-8,14-bis(2,4-difluorophenyl)-N,N-bis(2-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-amine (PubChem CID 163502653) has the molecular formula C52H46BF4N3 and a molecular weight of 799.77 g/mol. Its IUPAC name is 4,18-ditert-butyl-8,14-bis(2,4-difluorophenyl)-N,N-bis(2-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-amine.
| Compound Name | 4,18-ditert-butyl-8,14-bis(2,4-difluorophenyl)-N,N-bis(2-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-amine |
|---|---|
| PubChem CID | 163502653 |
| Molecular Formula | C52H46BF4N3 |
| Molecular Weight | 799.77 g/mol |
| Exact Mass | 799.37 |
| IUPAC Name | 4,18-ditert-butyl-8,14-bis(2,4-difluorophenyl)-N,N-bis(2-methylphenyl)-8,14-diaza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaen-11-amine |
| SMILES | Cc1ccccc1N(c1cc2c3c(c1)N(c1ccc(F)cc1F)c1ccc(C(C)(C)C)cc1B3c1cc(C(C)(C)C)ccc1N2c1ccc(F)cc1F)c1ccccc1C |
| InChI | InChI=1S/C52H46BF4N3/c1-31-13-9-11-15-42(31)58(43-16-12-10-14-32(43)2)37-29-48-50-49(30-37)60(47-24-20-36(55)28-41(47)57)45-22-18-34(52(6,7)8)26-39(45)53(50)38-25-33(51(3,4)5)17-21-44(38)59(48)46-23-19-35(54)27-40(46)56/h9-30H,1-8H3 |
| InChIKey | CWBBZSXTQGZBKS-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.77 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|