C19H28FNO5 — CID 163503026
N-[(2S,5S)-2-ethyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-5-(4-fluorophenyl)pentanamide (PubChem CID 163503026) has the molecular formula C19H28FNO5 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(2S,5S)-2-ethyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-5-(4-fluorophenyl)pentanamide.
| Compound Name | N-[(2S,5S)-2-ethyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-5-(4-fluorophenyl)pentanamide |
|---|---|
| PubChem CID | 163503026 |
| Molecular Formula | C19H28FNO5 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[(2S,5S)-2-ethyl-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]-5-(4-fluorophenyl)pentanamide |
| SMILES | CC[C@@H]1OC(CO)[C@@H](O)C(O)C1NC(=O)CCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H28FNO5/c1-2-14-17(19(25)18(24)15(11-22)26-14)21-16(23)6-4-3-5-12-7-9-13(20)10-8-12/h7-10,14-15,17-19,22,24-25H,2-6,11H2,1H3,(H,21,23)/t14-,15?,17?,18+,19?/m0/s1 |
| InChIKey | CWIGJDAJNQCVOS-ZEBODPKUSA-N |
| XLogP | 0.91 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|