About (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine
(4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine (PubChem CID 163503364) has the molecular formula C7H10I2N2
and a molecular weight of 375.98 g/mol. Its IUPAC name is (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine.
Molecular Properties
| Compound Name | (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine |
| PubChem CID | 163503364 |
| Molecular Formula | C7H10I2N2 |
| Molecular Weight | 375.98 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine |
| SMILES | [H]/N=C1\CN[C@H](I=C)C\C1=C/I |
| InChI | InChI=1S/C7H10I2N2/c1-9-7-2-5(3-8)6(10)4-11-7/h3,7,10-11H,1-2,4H2/b5-3+,10-6+/t7-/m0/s1 |
| InChIKey | CWPRQZXRZPQHBE-XXKLFVRWSA-N |
| XLogP | 2.05 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.98 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine?
The IUPAC name of (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine (CID 163503364) is (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine.
What is the SMILES notation for (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine?
The canonical SMILES for (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine is [H]/N=C1\CN[C@H](I=C)C\C1=C/I.
What is the InChIKey of (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine?
The InChIKey is CWPRQZXRZPQHBE-XXKLFVRWSA-N. The full InChI is InChI=1S/C7H10I2N2/c1-9-7-2-5(3-8)6(10)4-11-7/h3,7,10-11H,1-2,4H2/b5-3+,10-6+/t7-/m0/s1.
What are the key properties of (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine?
(4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine has a molecular weight of 375.98 g/mol, XLogP of 2.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6R)-4-(iodomethylidene)-6-(methylidene-λ3-iodanyl)piperidin-3-imine is sourced from PubChem (CID 163503364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).