2H-azepine-4-carboxylic acid

C7H7NO2 — CID 163503911

IUPAC2H-azepine-4-carboxylic acid
SMILESO=C(O)C1=CCN=CC=C1
InChIInChI=1S/C7H7NO2/c9-7(10)6-2-1-4-8-5-3-6/h1-4H,5H2,(H,9,10)
InChIKeyCWZLFTMTCVASTG-UHFFFAOYSA-N
MW137.14 g/mol
LogP0.64
Rot. Bonds1

About 2H-azepine-4-carboxylic acid

2H-azepine-4-carboxylic acid (PubChem CID 163503911) has the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. Its IUPAC name is 2H-azepine-4-carboxylic acid.

Molecular Properties

Compound Name2H-azepine-4-carboxylic acid
PubChem CID163503911
Molecular FormulaC7H7NO2
Molecular Weight137.14 g/mol
Exact Mass137.05
IUPAC Name2H-azepine-4-carboxylic acid
SMILESO=C(O)C1=CCN=CC=C1
InChIInChI=1S/C7H7NO2/c9-7(10)6-2-1-4-8-5-3-6/h1-4H,5H2,(H,9,10)
InChIKeyCWZLFTMTCVASTG-UHFFFAOYSA-N
XLogP0.64
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.14
LogP ≤ 50.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2H-azepine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2H-azepine-4-carboxylic acid?
The IUPAC name of 2H-azepine-4-carboxylic acid (CID 163503911) is 2H-azepine-4-carboxylic acid.
What is the SMILES notation for 2H-azepine-4-carboxylic acid?
The canonical SMILES for 2H-azepine-4-carboxylic acid is O=C(O)C1=CCN=CC=C1.
What is the InChIKey of 2H-azepine-4-carboxylic acid?
The InChIKey is CWZLFTMTCVASTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-7(10)6-2-1-4-8-5-3-6/h1-4H,5H2,(H,9,10).
What are the key properties of 2H-azepine-4-carboxylic acid?
2H-azepine-4-carboxylic acid has a molecular weight of 137.14 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-azepine-4-carboxylic acid is sourced from PubChem (CID 163503911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).