C10H14F3N5O — CID 163504448
(6S)-6-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 163504448) has the molecular formula C10H14F3N5O and a molecular weight of 277.25 g/mol. Its IUPAC name is (6S)-6-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | (6S)-6-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 163504448 |
| Molecular Formula | C10H14F3N5O |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (6S)-6-methyl-N-[(2R)-1,1,1-trifluoropropan-2-yl]-4,5,6,7-tetrahydrotriazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | C[C@H]1Cn2nnc(C(=O)N[C@H](C)C(F)(F)F)c2CN1 |
| InChI | InChI=1S/C10H14F3N5O/c1-5-4-18-7(3-14-5)8(16-17-18)9(19)15-6(2)10(11,12)13/h5-6,14H,3-4H2,1-2H3,(H,15,19)/t5-,6+/m0/s1 |
| InChIKey | CXKSOVKUFFVYAN-NTSWFWBYSA-N |
| XLogP | 0.45 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |