C22H46O4 — CID 163506336
1-ethoxy-3-(5-tritiopentoxy)-2,2-bis(5-tritiopentoxymethyl)propane (PubChem CID 163506336) has the molecular formula C22H46O4 and a molecular weight of 380.63 g/mol. Its IUPAC name is 1-ethoxy-3-(5-tritiopentoxy)-2,2-bis(5-tritiopentoxymethyl)propane.
| Compound Name | 1-ethoxy-3-(5-tritiopentoxy)-2,2-bis(5-tritiopentoxymethyl)propane |
|---|---|
| PubChem CID | 163506336 |
| Molecular Formula | C22H46O4 |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.36 |
| IUPAC Name | 1-ethoxy-3-(5-tritiopentoxy)-2,2-bis(5-tritiopentoxymethyl)propane |
| SMILES | [3H]CCCCCOCC(COCC)(COCCCCC[3H])COCCCCC[3H] |
| InChI | InChI=1S/C22H46O4/c1-5-9-12-15-24-19-22(18-23-8-4,20-25-16-13-10-6-2)21-26-17-14-11-7-3/h5-21H2,1-4H3/i1T,2T,3T |
| InChIKey | VMCIQOHMTJMPPY-YLZNBVSGSA-N |
| XLogP | 5.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|