C16H22O4 — CID 163506352
methyl (E)-3-[4-(6-oxohexoxy)cyclohexa-1,3-dien-1-yl]prop-2-enoate (PubChem CID 163506352) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl (E)-3-[4-(6-oxohexoxy)cyclohexa-1,3-dien-1-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-(6-oxohexoxy)cyclohexa-1,3-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 163506352 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methyl (E)-3-[4-(6-oxohexoxy)cyclohexa-1,3-dien-1-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=CC=C(OCCCCCC=O)CC1 |
| InChI | InChI=1S/C16H22O4/c1-19-16(18)11-8-14-6-9-15(10-7-14)20-13-5-3-2-4-12-17/h6,8-9,11-12H,2-5,7,10,13H2,1H3/b11-8+ |
| InChIKey | CYWOKSLHESSWNN-DHZHZOJOSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|