C44H71N4+ — CID 163507036
11-[4-(4,6-dicyclohexyl-1,3,5-triazinan-1-ium-2-yl)cyclohex-3-en-1-yl]-9-(4-methylcyclohexyl)-3,4,4a,6a,6b,7,8,9,10,10a,11a,11b-dodecahydrobenzo[a]carbazole (PubChem CID 163507036) has the molecular formula C44H71N4+ and a molecular weight of 656.08 g/mol. Its IUPAC name is 11-[4-(4,6-dicyclohexyl-1,3,5-triazinan-1-ium-2-yl)cyclohex-3-en-1-yl]-9-(4-methylcyclohexyl)-3,4,4a,6a,6b,7,8,9,10,10a,11a,11b-dodecahydrobenzo[a]carbazole.
| Compound Name | 11-[4-(4,6-dicyclohexyl-1,3,5-triazinan-1-ium-2-yl)cyclohex-3-en-1-yl]-9-(4-methylcyclohexyl)-3,4,4a,6a,6b,7,8,9,10,10a,11a,11b-dodecahydrobenzo[a]carbazole |
|---|---|
| PubChem CID | 163507036 |
| Molecular Formula | C44H71N4+ |
| Molecular Weight | 656.08 g/mol |
| Exact Mass | 655.57 |
| IUPAC Name | 11-[4-(4,6-dicyclohexyl-1,3,5-triazinan-1-ium-2-yl)cyclohex-3-en-1-yl]-9-(4-methylcyclohexyl)-3,4,4a,6a,6b,7,8,9,10,10a,11a,11b-dodecahydrobenzo[a]carbazole |
| SMILES | CC1CCC(C2CCC3C4C=CC5CCC=CC5C4N(C4CC=C(C5NC(C6CCCCC6)NC(C6CCCCC6)[NH2+]5)CC4)C3C2)CC1 |
| InChI | InChI=1S/C44H70N4/c1-29-16-18-30(19-17-29)35-23-26-38-39-27-22-31-10-8-9-15-37(31)41(39)48(40(38)28-35)36-24-20-34(21-25-36)44-46-42(32-11-4-2-5-12-32)45-43(47-44)33-13-6-3-7-14-33/h9,15,20,22,27,29-33,35-47H,2-8,10-14,16-19,21,23-26,28H2,1H3/p+1 |
| InChIKey | CZKPPEPKIOMNLP-UHFFFAOYSA-O |
| XLogP | 8.42 |
| TPSA | 43.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.08 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|