C40H60N5O9P — CID 163507308
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-3-[(Z)-octadec-9-enoxy]-2-phenylmethoxypropyl] hydrogen phosphate (PubChem CID 163507308) has the molecular formula C40H60N5O9P and a molecular weight of 785.92 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-3-[(Z)-octadec-9-enoxy]-2-phenylmethoxypropyl] hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-3-[(Z)-octadec-9-enoxy]-2-phenylmethoxypropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 163507308 |
| Molecular Formula | C40H60N5O9P |
| Molecular Weight | 785.92 g/mol |
| Exact Mass | 785.41 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-3-[(Z)-octadec-9-enoxy]-2-phenylmethoxypropyl] hydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC[C@H](COP(=O)(O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)OCc1ccccc1 |
| InChI | InChI=1S/C40H60N5O9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-25-50-27-33(51-26-32-21-18-17-19-22-32)28-52-55(48,49)53-29-35-37(46)38(47)40(30-41,54-35)36-24-23-34-39(42)43-31-44-45(34)36/h9-10,17-19,21-24,31,33,35,37-38,46-47H,2-8,11-16,20,25-29H2,1H3,(H,48,49)(H2,42,43,44)/b10-9-/t33-,35-,37-,38-,40+/m1/s1 |
| InChIKey | CZPXYEXDMOFOEM-DGMSWDPGSA-N |
| XLogP | 6.92 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.92 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|