C14H14Cl4 — CID 163507629
6,7,8,9-tetrachloro-1,2,3,4,4a,5,10,10a-octahydroanthracene (PubChem CID 163507629) has the molecular formula C14H14Cl4 and a molecular weight of 324.08 g/mol. Its IUPAC name is 6,7,8,9-tetrachloro-1,2,3,4,4a,5,10,10a-octahydroanthracene.
| Compound Name | 6,7,8,9-tetrachloro-1,2,3,4,4a,5,10,10a-octahydroanthracene |
|---|---|
| PubChem CID | 163507629 |
| Molecular Formula | C14H14Cl4 |
| Molecular Weight | 324.08 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 6,7,8,9-tetrachloro-1,2,3,4,4a,5,10,10a-octahydroanthracene |
| SMILES | ClC1=C(Cl)C(Cl)=C2C(Cl)=C3CCCCC3CC2C1 |
| InChI | InChI=1S/C14H14Cl4/c15-10-6-8-5-7-3-1-2-4-9(7)12(16)11(8)14(18)13(10)17/h7-8H,1-6H2 |
| InChIKey | CZWIQEDZUWMGQE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.08 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |