About 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine
5-ethyl-4-methylcyclohexa-1,5-dien-1-amine (PubChem CID 163507973) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 163507973 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CCC1=CC(N)=CCC1C |
| InChI | InChI=1S/C9H15N/c1-3-8-6-9(10)5-4-7(8)2/h5-7H,3-4,10H2,1-2H3 |
| InChIKey | DAEDESHQAIGRHC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine (CID 163507973) is 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine is CCC1=CC(N)=CCC1C.
What is the InChIKey of 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is DAEDESHQAIGRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-8-6-9(10)5-4-7(8)2/h5-7H,3-4,10H2,1-2H3.
What are the key properties of 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine?
5-ethyl-4-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 137.23 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 163507973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).