C20H25NO — CID 163509002
4-(2,8-dimethyl-1,2,3,4-tetrahydrodibenzofuran-4-yl)cyclohex-2-en-1-amine (PubChem CID 163509002) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-(2,8-dimethyl-1,2,3,4-tetrahydrodibenzofuran-4-yl)cyclohex-2-en-1-amine.
| Compound Name | 4-(2,8-dimethyl-1,2,3,4-tetrahydrodibenzofuran-4-yl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 163509002 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-(2,8-dimethyl-1,2,3,4-tetrahydrodibenzofuran-4-yl)cyclohex-2-en-1-amine |
| SMILES | Cc1ccc2oc3c(c2c1)CC(C)CC3C1C=CC(N)CC1 |
| InChI | InChI=1S/C20H25NO/c1-12-3-8-19-17(9-12)18-11-13(2)10-16(20(18)22-19)14-4-6-15(21)7-5-14/h3-4,6,8-9,13-16H,5,7,10-11,21H2,1-2H3 |
| InChIKey | DBBCKCDEYPNXQZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|