C14H20O2 — CID 163509320
2,2,5-trimethyl-5-(4-methylphenyl)-1,4-dioxane (PubChem CID 163509320) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2,2,5-trimethyl-5-(4-methylphenyl)-1,4-dioxane.
| Compound Name | 2,2,5-trimethyl-5-(4-methylphenyl)-1,4-dioxane |
|---|---|
| PubChem CID | 163509320 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2,2,5-trimethyl-5-(4-methylphenyl)-1,4-dioxane |
| SMILES | Cc1ccc(C2(C)COC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C14H20O2/c1-11-5-7-12(8-6-11)14(4)10-15-13(2,3)9-16-14/h5-8H,9-10H2,1-4H3 |
| InChIKey | DBHXYEFLSIEHQP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |