C26H26F2N4O5S — CID 163509324
N-[2-acetyl-4-[5-[(2,6-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]phenyl]-N'-(2-methyl-3-oxobutyl)methanimidamide (PubChem CID 163509324) has the molecular formula C26H26F2N4O5S and a molecular weight of 544.58 g/mol. Its IUPAC name is N-[2-acetyl-4-[5-[(2,6-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]phenyl]-N'-(2-methyl-3-oxobutyl)methanimidamide.
| Compound Name | N-[2-acetyl-4-[5-[(2,6-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]phenyl]-N'-(2-methyl-3-oxobutyl)methanimidamide |
|---|---|
| PubChem CID | 163509324 |
| Molecular Formula | C26H26F2N4O5S |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | N-[2-acetyl-4-[5-[(2,6-difluorophenyl)sulfonylamino]-6-methoxy-3-pyridinyl]phenyl]-N'-(2-methyl-3-oxobutyl)methanimidamide |
| SMILES | COc1ncc(-c2ccc(N/C=N/CC(C)C(C)=O)c(C(C)=O)c2)cc1NS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C26H26F2N4O5S/c1-15(16(2)33)12-29-14-31-23-9-8-18(10-20(23)17(3)34)19-11-24(26(37-4)30-13-19)32-38(35,36)25-21(27)6-5-7-22(25)28/h5-11,13-15,32H,12H2,1-4H3,(H,29,31) |
| InChIKey | DBIALUNSXPGVNR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|