C30H31N7O2 — CID 163509600
6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(3-nitro-3-phenylcyclobutyl)ethyl]pyrrolo[2,3-b]pyridine (PubChem CID 163509600) has the molecular formula C30H31N7O2 and a molecular weight of 521.63 g/mol. Its IUPAC name is 6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(3-nitro-3-phenylcyclobutyl)ethyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(3-nitro-3-phenylcyclobutyl)ethyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 163509600 |
| Molecular Formula | C30H31N7O2 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 6-(4-imidazo[1,2-a]pyridin-5-ylpiperazin-1-yl)-1-[2-(3-nitro-3-phenylcyclobutyl)ethyl]pyrrolo[2,3-b]pyridine |
| SMILES | O=[N+]([O-])C1(c2ccccc2)CC(CCn2ccc3ccc(N4CCN(c5cccc6nccn56)CC4)nc32)C1 |
| InChI | InChI=1S/C30H31N7O2/c38-37(39)30(25-5-2-1-3-6-25)21-23(22-30)11-14-35-15-12-24-9-10-27(32-29(24)35)33-17-19-34(20-18-33)28-8-4-7-26-31-13-16-36(26)28/h1-10,12-13,15-16,23H,11,14,17-22H2 |
| InChIKey | DBOKXDQMGHPHGQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|