C21H28ClN3O — CID 163509812
2-(3-chloro-2-methylanilino)-N-[3-(diethylamino)propyl]benzamide (PubChem CID 163509812) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is 2-(3-chloro-2-methylanilino)-N-[3-(diethylamino)propyl]benzamide.
| Compound Name | 2-(3-chloro-2-methylanilino)-N-[3-(diethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 163509812 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(3-chloro-2-methylanilino)-N-[3-(diethylamino)propyl]benzamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccccc1Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C21H28ClN3O/c1-4-25(5-2)15-9-14-23-21(26)17-10-6-7-12-20(17)24-19-13-8-11-18(22)16(19)3/h6-8,10-13,24H,4-5,9,14-15H2,1-3H3,(H,23,26) |
| InChIKey | DBSVHXGUKGKVAQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|