C21H20Cl2FN3O3 — CID 163509890
2-[1-[[4-[[(3,4-dichlorophenyl)-hydroxymethyl]amino]-2-fluorophenyl]methyl]-3,5-dimethylpyrazol-4-yl]acetic acid (PubChem CID 163509890) has the molecular formula C21H20Cl2FN3O3 and a molecular weight of 452.31 g/mol. Its IUPAC name is 2-[1-[[4-[[(3,4-dichlorophenyl)-hydroxymethyl]amino]-2-fluorophenyl]methyl]-3,5-dimethylpyrazol-4-yl]acetic acid.
| Compound Name | 2-[1-[[4-[[(3,4-dichlorophenyl)-hydroxymethyl]amino]-2-fluorophenyl]methyl]-3,5-dimethylpyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 163509890 |
| Molecular Formula | C21H20Cl2FN3O3 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 2-[1-[[4-[[(3,4-dichlorophenyl)-hydroxymethyl]amino]-2-fluorophenyl]methyl]-3,5-dimethylpyrazol-4-yl]acetic acid |
| SMILES | Cc1nn(Cc2ccc(NC(O)c3ccc(Cl)c(Cl)c3)cc2F)c(C)c1CC(=O)O |
| InChI | InChI=1S/C21H20Cl2FN3O3/c1-11-16(9-20(28)29)12(2)27(26-11)10-14-3-5-15(8-19(14)24)25-21(30)13-4-6-17(22)18(23)7-13/h3-8,21,25,30H,9-10H2,1-2H3,(H,28,29) |
| InChIKey | DBUQHSOMIPDGNX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|